C31H51NO2 — CID 54405245
3,7,11-trimethyldodeca-2,6,10-trienyl N-(3,7,11-trimethyldodeca-2,6,10-trienyl)carbamate (PubChem CID 54405245) has the molecular formula C31H51NO2 and a molecular weight of 469.75 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienyl N-(3,7,11-trimethyldodeca-2,6,10-trienyl)carbamate.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-(3,7,11-trimethyldodeca-2,6,10-trienyl)carbamate |
|---|---|
| PubChem CID | 54405245 |
| Molecular Formula | C31H51NO2 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.39 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-(3,7,11-trimethyldodeca-2,6,10-trienyl)carbamate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNC(=O)OCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C31H51NO2/c1-25(2)13-9-15-27(5)17-11-19-29(7)21-23-32-31(33)34-24-22-30(8)20-12-18-28(6)16-10-14-26(3)4/h13-14,17-18,21-22H,9-12,15-16,19-20,23-24H2,1-8H3,(H,32,33) |
| InChIKey | VQFXTJBPLIBMGE-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|