About [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate
[(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate (PubChem CID 54405377) has the molecular formula C11H5Cl2N3O6
and a molecular weight of 346.08 g/mol. Its IUPAC name is [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate.
Molecular Properties
| Compound Name | [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate |
| PubChem CID | 54405377 |
| Molecular Formula | C11H5Cl2N3O6 |
| Molecular Weight | 346.08 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate |
| SMILES | CC(=O)ON=C1C(=O)Nc2cc(Cl)c(Cl)c([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C11H5Cl2N3O6/c1-3(17)22-15-8-10(18)6-5(14-11(8)19)2-4(12)7(13)9(6)16(20)21/h2H,1H3,(H,14,19) |
| InChIKey | VQHXPPSSUDHRCT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.08 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate?
The IUPAC name of [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate (CID 54405377) is [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate.
What is the SMILES notation for [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate?
The canonical SMILES for [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate is CC(=O)ON=C1C(=O)Nc2cc(Cl)c(Cl)c([N+](=O)[O-])c2C1=O.
What is the InChIKey of [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate?
The InChIKey is VQHXPPSSUDHRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2N3O6/c1-3(17)22-15-8-10(18)6-5(14-11(8)19)2-4(12)7(13)9(6)16(20)21/h2H,1H3,(H,14,19).
What are the key properties of [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate?
[(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate has a molecular weight of 346.08 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(6,7-dichloro-5-nitro-2,4-dioxo-1H-quinolin-3-ylidene)amino] acetate is sourced from PubChem (CID 54405377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).