About N-penta-2,4-dienyl-N-prop-2-enylacetamide
N-penta-2,4-dienyl-N-prop-2-enylacetamide (PubChem CID 54405580) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-penta-2,4-dienyl-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | N-penta-2,4-dienyl-N-prop-2-enylacetamide |
| PubChem CID | 54405580 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-penta-2,4-dienyl-N-prop-2-enylacetamide |
| SMILES | C=CC=CCN(CC=C)C(C)=O |
| InChI | InChI=1S/C10H15NO/c1-4-6-7-9-11(8-5-2)10(3)12/h4-7H,1-2,8-9H2,3H3 |
| InChIKey | VQLHPQZBUBEIBX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-penta-2,4-dienyl-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-penta-2,4-dienyl-N-prop-2-enylacetamide?
The IUPAC name of N-penta-2,4-dienyl-N-prop-2-enylacetamide (CID 54405580) is N-penta-2,4-dienyl-N-prop-2-enylacetamide.
What is the SMILES notation for N-penta-2,4-dienyl-N-prop-2-enylacetamide?
The canonical SMILES for N-penta-2,4-dienyl-N-prop-2-enylacetamide is C=CC=CCN(CC=C)C(C)=O.
What is the InChIKey of N-penta-2,4-dienyl-N-prop-2-enylacetamide?
The InChIKey is VQLHPQZBUBEIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-4-6-7-9-11(8-5-2)10(3)12/h4-7H,1-2,8-9H2,3H3.
What are the key properties of N-penta-2,4-dienyl-N-prop-2-enylacetamide?
N-penta-2,4-dienyl-N-prop-2-enylacetamide has a molecular weight of 165.24 g/mol, XLogP of 1.76, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-penta-2,4-dienyl-N-prop-2-enylacetamide is sourced from PubChem (CID 54405580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).