About diethyl 2-acetylnon-4-enedioate
diethyl 2-acetylnon-4-enedioate (PubChem CID 54405770) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is diethyl 2-acetylnon-4-enedioate.
Molecular Properties
| Compound Name | diethyl 2-acetylnon-4-enedioate |
| PubChem CID | 54405770 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | diethyl 2-acetylnon-4-enedioate |
| SMILES | CCOC(=O)CCCC=CCC(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C15H24O5/c1-4-19-14(17)11-9-7-6-8-10-13(12(3)16)15(18)20-5-2/h6,8,13H,4-5,7,9-11H2,1-3H3 |
| InChIKey | VQOFCBURQXEDDL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetylnon-4-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetylnon-4-enedioate?
The IUPAC name of diethyl 2-acetylnon-4-enedioate (CID 54405770) is diethyl 2-acetylnon-4-enedioate.
What is the SMILES notation for diethyl 2-acetylnon-4-enedioate?
The canonical SMILES for diethyl 2-acetylnon-4-enedioate is CCOC(=O)CCCC=CCC(C(C)=O)C(=O)OCC.
What is the InChIKey of diethyl 2-acetylnon-4-enedioate?
The InChIKey is VQOFCBURQXEDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O5/c1-4-19-14(17)11-9-7-6-8-10-13(12(3)16)15(18)20-5-2/h6,8,13H,4-5,7,9-11H2,1-3H3.
What are the key properties of diethyl 2-acetylnon-4-enedioate?
diethyl 2-acetylnon-4-enedioate has a molecular weight of 284.35 g/mol, XLogP of 2.43, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetylnon-4-enedioate is sourced from PubChem (CID 54405770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).