C28H45NO — CID 54406255
3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-N-(2,4,4-trimethylpentan-2-yl)nona-2,4,6,8-tetraenamide (PubChem CID 54406255) has the molecular formula C28H45NO and a molecular weight of 411.67 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-N-(2,4,4-trimethylpentan-2-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-N-(2,4,4-trimethylpentan-2-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 54406255 |
| Molecular Formula | C28H45NO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.35 |
| IUPAC Name | 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-N-(2,4,4-trimethylpentan-2-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C28H45NO/c1-21(16-17-24-23(3)15-12-18-27(24,7)8)13-11-14-22(2)19-25(30)29-28(9,10)20-26(4,5)6/h11,13-14,16-17,19H,12,15,18,20H2,1-10H3,(H,29,30) |
| InChIKey | VQWXGJKROABVLN-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|