About N-hexyl-3-methyl-1,2-thiazole-5-carboxamide
N-hexyl-3-methyl-1,2-thiazole-5-carboxamide (PubChem CID 54406516) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is N-hexyl-3-methyl-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-hexyl-3-methyl-1,2-thiazole-5-carboxamide |
| PubChem CID | 54406516 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-hexyl-3-methyl-1,2-thiazole-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc(C)ns1 |
| InChI | InChI=1S/C11H18N2OS/c1-3-4-5-6-7-12-11(14)10-8-9(2)13-15-10/h8H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | VRBNSNRNLIIBCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-3-methyl-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-3-methyl-1,2-thiazole-5-carboxamide?
The IUPAC name of N-hexyl-3-methyl-1,2-thiazole-5-carboxamide (CID 54406516) is N-hexyl-3-methyl-1,2-thiazole-5-carboxamide.
What is the SMILES notation for N-hexyl-3-methyl-1,2-thiazole-5-carboxamide?
The canonical SMILES for N-hexyl-3-methyl-1,2-thiazole-5-carboxamide is CCCCCCNC(=O)c1cc(C)ns1.
What is the InChIKey of N-hexyl-3-methyl-1,2-thiazole-5-carboxamide?
The InChIKey is VRBNSNRNLIIBCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-3-4-5-6-7-12-11(14)10-8-9(2)13-15-10/h8H,3-7H2,1-2H3,(H,12,14).
What are the key properties of N-hexyl-3-methyl-1,2-thiazole-5-carboxamide?
N-hexyl-3-methyl-1,2-thiazole-5-carboxamide has a molecular weight of 226.34 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-3-methyl-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 54406516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).