About 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate
2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate (PubChem CID 54406722) has the molecular formula C27H25Br2N3O4
and a molecular weight of 615.32 g/mol. Its IUPAC name is 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate |
| PubChem CID | 54406722 |
| Molecular Formula | C27H25Br2N3O4 |
| Molecular Weight | 615.32 g/mol |
| Exact Mass | 613.02 |
| IUPAC Name | 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate |
| SMILES | Brc1ccccn1.COC(=O)c1cccnc1Br.COC(=O)c1cccnc1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C15H15NO2.C7H6BrNO2.C5H4BrN/c1-11-5-7-12(8-6-11)10-14-13(15(17)18-2)4-3-9-16-14;1-11-7(10)5-3-2-4-9-6(5)8;6-5-3-1-2-4-7-5/h3-9H,10H2,1-2H3;2-4H,1H3;1-4H |
| InChIKey | VRFHSAZXOSXDSQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.32 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate?
The IUPAC name of 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate (CID 54406722) is 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate.
What is the SMILES notation for 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate?
The canonical SMILES for 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate is Brc1ccccn1.COC(=O)c1cccnc1Br.COC(=O)c1cccnc1Cc1ccc(C)cc1.
What is the InChIKey of 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate?
The InChIKey is VRFHSAZXOSXDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2.C7H6BrNO2.C5H4BrN/c1-11-5-7-12(8-6-11)10-14-13(15(17)18-2)4-3-9-16-14;1-11-7(10)5-3-2-4-9-6(5)8;6-5-3-1-2-4-7-5/h3-9H,10H2,1-2H3;2-4H,1H3;1-4H.
What are the key properties of 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate?
2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate has a molecular weight of 615.32 g/mol, XLogP of 6.24, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyridine;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(4-methylphenyl)methyl]pyridine-3-carboxylate is sourced from PubChem (CID 54406722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).