About 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane
2-(1,3-oxathiolan-2-yl)-1,3-oxathiane (PubChem CID 54406939) has the molecular formula C7H12O2S2
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane |
| PubChem CID | 54406939 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane |
| SMILES | C1COC(C2OCCS2)SC1 |
| InChI | InChI=1S/C7H12O2S2/c1-2-8-6(10-4-1)7-9-3-5-11-7/h6-7H,1-5H2 |
| InChIKey | JMEZZKMGYFWEHF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane?
The IUPAC name of 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane (CID 54406939) is 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane.
What is the SMILES notation for 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane?
The canonical SMILES for 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane is C1COC(C2OCCS2)SC1.
What is the InChIKey of 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane?
The InChIKey is JMEZZKMGYFWEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-2-8-6(10-4-1)7-9-3-5-11-7/h6-7H,1-5H2.
What are the key properties of 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane?
2-(1,3-oxathiolan-2-yl)-1,3-oxathiane has a molecular weight of 192.30 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxathiolan-2-yl)-1,3-oxathiane is sourced from PubChem (CID 54406939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).