About N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide
N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide (PubChem CID 54407798) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide.
Molecular Properties
| Compound Name | N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide |
| PubChem CID | 54407798 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide |
| SMILES | C/N=C(\C)N(C)C.CN=C(C)C |
| InChI | InChI=1S/C5H12N2.C4H9N/c1-5(6-2)7(3)4;1-4(2)5-3/h1-4H3;1-3H3/b6-5+; |
| InChIKey | VRZAAKCSBTVRLM-IPZCTEOASA-N |
| XLogP | 1.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide?
The IUPAC name of N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide (CID 54407798) is N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide.
What is the SMILES notation for N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide?
The canonical SMILES for N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide is C/N=C(\C)N(C)C.CN=C(C)C.
What is the InChIKey of N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide?
The InChIKey is VRZAAKCSBTVRLM-IPZCTEOASA-N. The full InChI is InChI=1S/C5H12N2.C4H9N/c1-5(6-2)7(3)4;1-4(2)5-3/h1-4H3;1-3H3/b6-5+;.
What are the key properties of N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide?
N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide has a molecular weight of 171.29 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-2-imine;N,N,N'-trimethylethanimidamide is sourced from PubChem (CID 54407798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).