About 2-amino-6-nitrobenzamide
2-amino-6-nitrobenzamide (PubChem CID 54407937) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-amino-6-nitrobenzamide.
Molecular Properties
| Compound Name | 2-amino-6-nitrobenzamide |
| PubChem CID | 54407937 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-amino-6-nitrobenzamide |
| SMILES | NC(=O)c1c(N)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O3/c8-4-2-1-3-5(10(12)13)6(4)7(9)11/h1-3H,8H2,(H2,9,11) |
| InChIKey | VSBVFLVLPDTKPJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-nitrobenzamide?
The IUPAC name of 2-amino-6-nitrobenzamide (CID 54407937) is 2-amino-6-nitrobenzamide.
What is the SMILES notation for 2-amino-6-nitrobenzamide?
The canonical SMILES for 2-amino-6-nitrobenzamide is NC(=O)c1c(N)cccc1[N+](=O)[O-].
What is the InChIKey of 2-amino-6-nitrobenzamide?
The InChIKey is VSBVFLVLPDTKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c8-4-2-1-3-5(10(12)13)6(4)7(9)11/h1-3H,8H2,(H2,9,11).
What are the key properties of 2-amino-6-nitrobenzamide?
2-amino-6-nitrobenzamide has a molecular weight of 181.15 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-nitrobenzamide is sourced from PubChem (CID 54407937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).