C24H25FN4O — CID 54407990
N'-[5-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-3-yl]piperidine-1-carboximidamide (PubChem CID 54407990) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is N'-[5-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-3-yl]piperidine-1-carboximidamide.
| Compound Name | N'-[5-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-3-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 54407990 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N'-[5-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-3-yl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\c1cc(C2(c3ccc(-c4ccccc4)c(F)c3)CC2)on1)N1CCCCC1 |
| InChI | InChI=1S/C24H25FN4O/c25-20-15-18(9-10-19(20)17-7-3-1-4-8-17)24(11-12-24)21-16-22(28-30-21)27-23(26)29-13-5-2-6-14-29/h1,3-4,7-10,15-16H,2,5-6,11-14H2,(H2,26,27,28) |
| InChIKey | VSCRNPVAJXEXRO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|