C31H49NO3 — CID 54409013
ethyl 3,7,11,15,19-pentamethyl-20-oxo-20-pyrrolidin-1-ylicosa-2,6,10,14,18-pentaenoate (PubChem CID 54409013) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is ethyl 3,7,11,15,19-pentamethyl-20-oxo-20-pyrrolidin-1-ylicosa-2,6,10,14,18-pentaenoate.
| Compound Name | ethyl 3,7,11,15,19-pentamethyl-20-oxo-20-pyrrolidin-1-ylicosa-2,6,10,14,18-pentaenoate |
|---|---|
| PubChem CID | 54409013 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | ethyl 3,7,11,15,19-pentamethyl-20-oxo-20-pyrrolidin-1-ylicosa-2,6,10,14,18-pentaenoate |
| SMILES | CCOC(=O)C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C31H49NO3/c1-7-35-30(33)24-28(5)20-12-18-26(3)16-10-14-25(2)15-11-17-27(4)19-13-21-29(6)31(34)32-22-8-9-23-32/h14,17-18,21,24H,7-13,15-16,19-20,22-23H2,1-6H3 |
| InChIKey | VSUCLJZUXQILGX-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|