About dec-4-enyl 5-oxopyrrolidine-2-carboxylate
dec-4-enyl 5-oxopyrrolidine-2-carboxylate (PubChem CID 54409682) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is dec-4-enyl 5-oxopyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | dec-4-enyl 5-oxopyrrolidine-2-carboxylate |
| PubChem CID | 54409682 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | dec-4-enyl 5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCC=CCCCOC(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C15H25NO3/c1-2-3-4-5-6-7-8-9-12-19-15(18)13-10-11-14(17)16-13/h6-7,13H,2-5,8-12H2,1H3,(H,16,17) |
| InChIKey | VTFOOPHCKYIVMB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-4-enyl 5-oxopyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-4-enyl 5-oxopyrrolidine-2-carboxylate?
The IUPAC name of dec-4-enyl 5-oxopyrrolidine-2-carboxylate (CID 54409682) is dec-4-enyl 5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for dec-4-enyl 5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for dec-4-enyl 5-oxopyrrolidine-2-carboxylate is CCCCCC=CCCCOC(=O)C1CCC(=O)N1.
What is the InChIKey of dec-4-enyl 5-oxopyrrolidine-2-carboxylate?
The InChIKey is VTFOOPHCKYIVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO3/c1-2-3-4-5-6-7-8-9-12-19-15(18)13-10-11-14(17)16-13/h6-7,13H,2-5,8-12H2,1H3,(H,16,17).
What are the key properties of dec-4-enyl 5-oxopyrrolidine-2-carboxylate?
dec-4-enyl 5-oxopyrrolidine-2-carboxylate has a molecular weight of 267.37 g/mol, XLogP of 2.72, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-4-enyl 5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 54409682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).