C10H9Cl4NO2S — CID 54409837
2-(1,1,2,2-tetrachloroethylsulfanyl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 54409837) has the molecular formula C10H9Cl4NO2S and a molecular weight of 349.07 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrachloroethylsulfanyl)-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-(1,1,2,2-tetrachloroethylsulfanyl)-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54409837 |
| Molecular Formula | C10H9Cl4NO2S |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.91 |
| IUPAC Name | 2-(1,1,2,2-tetrachloroethylsulfanyl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1SC(Cl)(Cl)C(Cl)Cl)CC=CC2 |
| InChI | InChI=1S/C10H9Cl4NO2S/c11-9(12)10(13,14)18-15-7(16)5-3-1-2-4-6(5)8(15)17/h1-2,9,16-17H,3-4H2 |
| InChIKey | VTIICEULKUFPJJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|