About 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one
2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one (PubChem CID 54409839) has the molecular formula C15H8FN3O
and a molecular weight of 265.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one |
| PubChem CID | 54409839 |
| Molecular Formula | C15H8FN3O |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one |
| SMILES | O=C1c2ccccc2-c2nc(-c3ccc(F)cc3)nn21 |
| InChI | InChI=1S/C15H8FN3O/c16-10-7-5-9(6-8-10)13-17-14-11-3-1-2-4-12(11)15(20)19(14)18-13/h1-8H |
| InChIKey | VTIISJOWZYDYNM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one?
The IUPAC name of 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one (CID 54409839) is 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one.
What is the SMILES notation for 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one?
The canonical SMILES for 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one is O=C1c2ccccc2-c2nc(-c3ccc(F)cc3)nn21.
What is the InChIKey of 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one?
The InChIKey is VTIISJOWZYDYNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8FN3O/c16-10-7-5-9(6-8-10)13-17-14-11-3-1-2-4-12(11)15(20)19(14)18-13/h1-8H.
What are the key properties of 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one?
2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one has a molecular weight of 265.25 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-b]isoindol-5-one is sourced from PubChem (CID 54409839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).