C17H22 — CID 54410227
5,11-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene (PubChem CID 54410227) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 5,11-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene.
| Compound Name | 5,11-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene |
|---|---|
| PubChem CID | 54410227 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 5,11-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-4,10-diene |
| SMILES | CC1=CC2C(C1)C1CC2C2C3CC(C=C3C)C12 |
| InChI | InChI=1S/C17H22/c1-8-3-12-13(4-8)15-7-14(12)16-10-5-9(2)11(6-10)17(15)16/h4-5,10-17H,3,6-7H2,1-2H3 |
| InChIKey | VTPCMVFQVMIBAC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|