About 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione
19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione (PubChem CID 54410360) has the molecular formula C41H77NO2
and a molecular weight of 616.07 g/mol. Its IUPAC name is 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione.
Molecular Properties
| Compound Name | 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione |
| PubChem CID | 54410360 |
| Molecular Formula | C41H77NO2 |
| Molecular Weight | 616.07 g/mol |
| Exact Mass | 615.60 |
| IUPAC Name | 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(CC)(C(=O)CCCCCCCC=CCCCCCCCC)N(C)C |
| InChI | InChI=1S/C41H77NO2/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(43)41(8-3,42(4)5)40(44)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h21-24H,6-20,25-38H2,1-5H3 |
| InChIKey | VTROITSGDDICNE-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.07 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione?
The IUPAC name of 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione (CID 54410360) is 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione.
What is the SMILES notation for 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione?
The canonical SMILES for 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione is CCCCCCCCC=CCCCCCCCC(=O)C(CC)(C(=O)CCCCCCCC=CCCCCCCCC)N(C)C.
What is the InChIKey of 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione?
The InChIKey is VTROITSGDDICNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H77NO2/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(43)41(8-3,42(4)5)40(44)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h21-24H,6-20,25-38H2,1-5H3.
What are the key properties of 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione?
19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione has a molecular weight of 616.07 g/mol, XLogP of 12.91, 34 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 19-(dimethylamino)-19-ethylheptatriaconta-9,28-diene-18,20-dione is sourced from PubChem (CID 54410360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).