C25H23F6N3O6 — CID 54410501
5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-ethyl 4-(3-nitrophenyl)-2,6-bis(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54410501) has the molecular formula C25H23F6N3O6 and a molecular weight of 575.46 g/mol. Its IUPAC name is 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-ethyl 4-(3-nitrophenyl)-2,6-bis(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-ethyl 4-(3-nitrophenyl)-2,6-bis(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54410501 |
| Molecular Formula | C25H23F6N3O6 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 5-O-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl] 3-O-ethyl 4-(3-nitrophenyl)-2,6-bis(trifluoromethyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C(F)(F)F)=NC(C(F)(F)F)=C(C(=O)OCCc2cc(C)[nH]c2C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23F6N3O6/c1-4-39-22(35)18-17(15-6-5-7-16(11-15)34(37)38)19(21(25(29,30)31)33-20(18)24(26,27)28)23(36)40-9-8-14-10-12(2)32-13(14)3/h5-7,10-11,17-18,32H,4,8-9H2,1-3H3 |
| InChIKey | VTUFJDWCEYHUDO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|