C14H8O4 — CID 54410730
3,9-dioxatricyclo[9.2.2.14,8]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-2,10-dione (PubChem CID 54410730) has the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3,9-dioxatricyclo[9.2.2.14,8]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-2,10-dione.
| Compound Name | 3,9-dioxatricyclo[9.2.2.14,8]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-2,10-dione |
|---|---|
| PubChem CID | 54410730 |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 3,9-dioxatricyclo[9.2.2.14,8]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-2,10-dione |
| SMILES | O=C1Oc2cccc(c2)OC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C14H8O4/c15-13-9-4-6-10(7-5-9)14(16)18-12-3-1-2-11(8-12)17-13/h1-8H |
| InChIKey | VTXUGHWRBWRSDI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|