C23H34Si — CID 54410776
2,4,5,6,7,8-hexahydroazulen-2-yl-(4,5,6,7,8,9-hexahydro-2H-cyclopenta[8]annulen-2-yl)-dimethylsilane (PubChem CID 54410776) has the molecular formula C23H34Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 2,4,5,6,7,8-hexahydroazulen-2-yl-(4,5,6,7,8,9-hexahydro-2H-cyclopenta[8]annulen-2-yl)-dimethylsilane.
| Compound Name | 2,4,5,6,7,8-hexahydroazulen-2-yl-(4,5,6,7,8,9-hexahydro-2H-cyclopenta[8]annulen-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 54410776 |
| Molecular Formula | C23H34Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2,4,5,6,7,8-hexahydroazulen-2-yl-(4,5,6,7,8,9-hexahydro-2H-cyclopenta[8]annulen-2-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1C=C2CCCCCCC2=C1)C1C=C2CCCCCC2=C1 |
| InChI | InChI=1S/C23H34Si/c1-24(2,23-16-20-12-8-5-9-13-21(20)17-23)22-14-18-10-6-3-4-7-11-19(18)15-22/h14-17,22-23H,3-13H2,1-2H3 |
| InChIKey | VTYOGBPPVDXJTC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|