C6H4N4O4 — CID 54411856
2,6,8-trioxo-7,9-dihydro-3H-purine-1-carbaldehyde (PubChem CID 54411856) has the molecular formula C6H4N4O4 and a molecular weight of 196.12 g/mol. Its IUPAC name is 2,6,8-trioxo-7,9-dihydro-3H-purine-1-carbaldehyde.
| Compound Name | 2,6,8-trioxo-7,9-dihydro-3H-purine-1-carbaldehyde |
|---|---|
| PubChem CID | 54411856 |
| Molecular Formula | C6H4N4O4 |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 2,6,8-trioxo-7,9-dihydro-3H-purine-1-carbaldehyde |
| SMILES | O=Cn1c(=O)[nH]c2[nH]c(=O)[nH]c2c1=O |
| InChI | InChI=1S/C6H4N4O4/c11-1-10-4(12)2-3(9-6(10)14)8-5(13)7-2/h1H,(H,9,14)(H2,7,8,13) |
| InChIKey | VURVSFDBOIPNOV-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|