About 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile
4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 54412549) has the molecular formula C17H17F3N2O2
and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile |
| PubChem CID | 54412549 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(CCCCCOc2ccc(C#N)cc2C(F)(F)F)on1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-12-9-14(24-22-12)5-3-2-4-8-23-16-7-6-13(11-21)10-15(16)17(18,19)20/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | VVDNMQJYCJZHPS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile (CID 54412549) is 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile is Cc1cc(CCCCCOc2ccc(C#N)cc2C(F)(F)F)on1.
What is the InChIKey of 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The InChIKey is VVDNMQJYCJZHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2O2/c1-12-9-14(24-22-12)5-3-2-4-8-23-16-7-6-13(11-21)10-15(16)17(18,19)20/h6-7,9-10H,2-5,8H2,1H3.
What are the key properties of 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile has a molecular weight of 338.33 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 54412549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).