About 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene
8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene (PubChem CID 54413202) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene.
Molecular Properties
| Compound Name | 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene |
| PubChem CID | 54413202 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene |
| SMILES | C1=C2CCCC2C2CCCOC2O1 |
| InChI | InChI=1S/C11H16O2/c1-3-8-7-13-11-10(9(8)4-1)5-2-6-12-11/h7,9-11H,1-6H2 |
| InChIKey | VVPBHBUWFNOGFB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene?
The IUPAC name of 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene (CID 54413202) is 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene.
What is the SMILES notation for 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene?
The canonical SMILES for 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene is C1=C2CCCC2C2CCCOC2O1.
What is the InChIKey of 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene?
The InChIKey is VVPBHBUWFNOGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-8-7-13-11-10(9(8)4-1)5-2-6-12-11/h7,9-11H,1-6H2.
What are the key properties of 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene?
8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene has a molecular weight of 180.25 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,10-dioxatricyclo[7.4.0.02,6]tridec-6-ene is sourced from PubChem (CID 54413202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).