C24H47NO7 — CID 54413416
9-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]octadecanoic acid (PubChem CID 54413416) has the molecular formula C24H47NO7 and a molecular weight of 461.64 g/mol. Its IUPAC name is 9-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]octadecanoic acid.
| Compound Name | 9-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]octadecanoic acid |
|---|---|
| PubChem CID | 54413416 |
| Molecular Formula | C24H47NO7 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | 9-[[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]octadecanoic acid |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)O)NC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H47NO7/c1-2-3-4-5-6-8-11-14-18(15-12-9-7-10-13-16-20(27)28)25-24-23(31)22(30)21(29)19(17-26)32-24/h18-19,21-26,29-31H,2-17H2,1H3,(H,27,28)/t18?,19-,21+,22+,23-,24?/m1/s1 |
| InChIKey | VVSMGBDVRLNGNV-SELBWNIISA-N |
| XLogP | 2.70 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|