C36H55NO6Si — CID 54413468
(2R,4S,5S)-2-but-2-enyl-9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-7,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 54413468) has the molecular formula C36H55NO6Si and a molecular weight of 625.92 g/mol. Its IUPAC name is (2R,4S,5S)-2-but-2-enyl-9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-7,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | (2R,4S,5S)-2-but-2-enyl-9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-7,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 54413468 |
| Molecular Formula | C36H55NO6Si |
| Molecular Weight | 625.92 g/mol |
| Exact Mass | 625.38 |
| IUPAC Name | (2R,4S,5S)-2-but-2-enyl-9-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-7,7-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | CC=CC[C@H](C[C@H](O)[C@H](CC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C36H55NO6Si/c1-10-11-18-27(32(39)40)25-31(38)30(37-33(41)43-34(2,3)4)26-36(8,9)23-24-42-44(35(5,6)7,28-19-14-12-15-20-28)29-21-16-13-17-22-29/h10-17,19-22,27,30-31,38H,18,23-26H2,1-9H3,(H,37,41)(H,39,40)/t27-,30+,31+/m1/s1 |
| InChIKey | VVTFPEDOJRYZEP-RDAHNBDFSA-N |
| XLogP | 6.68 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.92 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|