C11H15NO3 — CID 54413523
tert-butyl 3-oxo-2-azabicyclo[2.2.1]hept-4-ene-2-carboxylate (PubChem CID 54413523) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-azabicyclo[2.2.1]hept-4-ene-2-carboxylate.
| Compound Name | tert-butyl 3-oxo-2-azabicyclo[2.2.1]hept-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 54413523 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | tert-butyl 3-oxo-2-azabicyclo[2.2.1]hept-4-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2=CCC1C2 |
| InChI | InChI=1S/C11H15NO3/c1-11(2,3)15-10(14)12-8-5-4-7(6-8)9(12)13/h4,8H,5-6H2,1-3H3 |
| InChIKey | VVUDHTAMUOLQFL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |