About 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea
1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea (PubChem CID 54414040) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea |
| PubChem CID | 54414040 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea |
| SMILES | [H]/N=C(\N)N(C(N)=O)c1c(C)cc(O)c(O)c1C |
| InChI | InChI=1S/C10H14N4O3/c1-4-3-6(15)8(16)5(2)7(4)14(9(11)12)10(13)17/h3,15-16H,1-2H3,(H3,11,12)(H2,13,17) |
| InChIKey | VWCQXOKWHRJEGT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea?
The IUPAC name of 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea (CID 54414040) is 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea.
What is the SMILES notation for 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea?
The canonical SMILES for 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea is [H]/N=C(\N)N(C(N)=O)c1c(C)cc(O)c(O)c1C.
What is the InChIKey of 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea?
The InChIKey is VWCQXOKWHRJEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O3/c1-4-3-6(15)8(16)5(2)7(4)14(9(11)12)10(13)17/h3,15-16H,1-2H3,(H3,11,12)(H2,13,17).
What are the key properties of 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea?
1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea has a molecular weight of 238.25 g/mol, XLogP of 0.49, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-1-(3,4-dihydroxy-2,6-dimethylphenyl)urea is sourced from PubChem (CID 54414040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).