C28H32N6O8 — CID 54414374
(4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(2-imidazol-1-ylacetyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 54414374) has the molecular formula C28H32N6O8 and a molecular weight of 580.60 g/mol. Its IUPAC name is (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(2-imidazol-1-ylacetyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(2-imidazol-1-ylacetyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54414374 |
| Molecular Formula | C28H32N6O8 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (4S,12aS)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[(2-imidazol-1-ylacetyl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Cn2ccnc2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H32N6O8/c1-32(2)16-9-15(31-17(35)10-34-6-5-30-11-34)22(36)19-13(16)7-12-8-14-21(33(3)4)24(38)20(27(29)41)26(40)28(14,42)25(39)18(12)23(19)37/h5-6,9,11-12,14,18,20-21,36,42H,7-8,10H2,1-4H3,(H2,29,41)(H,31,35)/t12?,14?,18?,20?,21-,28-/m0/s1 |
| InChIKey | VWIZFMVJYNHOSY-CXIUKJSQSA-N |
| XLogP | -1.23 |
| TPSA | 205.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|