C20H23N2O+ — CID 54414440
17-butyl-17-aza-15-azoniatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7,9,11,13-hexaene 15-oxide (PubChem CID 54414440) has the molecular formula C20H23N2O+ and a molecular weight of 307.42 g/mol. Its IUPAC name is 17-butyl-17-aza-15-azoniatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7,9,11,13-hexaene 15-oxide.
| Compound Name | 17-butyl-17-aza-15-azoniatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7,9,11,13-hexaene 15-oxide |
|---|---|
| PubChem CID | 54414440 |
| Molecular Formula | C20H23N2O+ |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 17-butyl-17-aza-15-azoniatetracyclo[8.8.0.01,14.03,8]octadeca-3,5,7,9,11,13-hexaene 15-oxide |
| SMILES | CCCCN1C[N+](=O)C2=CC=CC3=Cc4ccccc4CC32C1 |
| InChI | InChI=1S/C20H23N2O/c1-2-3-11-21-14-20-13-17-8-5-4-7-16(17)12-18(20)9-6-10-19(20)22(23)15-21/h4-10,12H,2-3,11,13-15H2,1H3/q+1 |
| InChIKey | IHDIYVHZLUFWJO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|