C33H34N2O5S — CID 54414458
5,5-dibenzyl-3-[1-[3-(1H-imidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]oxolane-2,4-dione (PubChem CID 54414458) has the molecular formula C33H34N2O5S and a molecular weight of 570.71 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[1-[3-(1H-imidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]oxolane-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[1-[3-(1H-imidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 54414458 |
| Molecular Formula | C33H34N2O5S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 5,5-dibenzyl-3-[1-[3-(1H-imidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]oxolane-2,4-dione |
| SMILES | CC(C)(C)C(c1cccc(CS(=O)(=O)c2ncc[nH]2)c1)C1C(=O)OC(Cc2ccccc2)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C33H34N2O5S/c1-32(2,3)28(26-16-10-15-25(19-26)22-41(38,39)31-34-17-18-35-31)27-29(36)33(40-30(27)37,20-23-11-6-4-7-12-23)21-24-13-8-5-9-14-24/h4-19,27-28H,20-22H2,1-3H3,(H,34,35) |
| InChIKey | VWKOOFZFOIOEDK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|