C12H6BrF11N2O — CID 54414579
4-bromo-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,2-diamine (PubChem CID 54414579) has the molecular formula C12H6BrF11N2O and a molecular weight of 483.08 g/mol. Its IUPAC name is 4-bromo-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 54414579 |
| Molecular Formula | C12H6BrF11N2O |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 4-bromo-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H6BrF11N2O/c13-3-1-4(25)5(26)2-6(3)27-8(15)7(14)9(16,17)10(18,19)11(20,21)12(22,23)24/h1-2H,25-26H2 |
| InChIKey | VWMOGMQRFKPYKF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|