C19H18N4O4 — CID 54415238
ethyl 13-[[formyl(methyl)amino]methyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-4-carboxylate (PubChem CID 54415238) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 13-[[formyl(methyl)amino]methyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-4-carboxylate.
| Compound Name | ethyl 13-[[formyl(methyl)amino]methyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 54415238 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | ethyl 13-[[formyl(methyl)amino]methyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-4-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c([nH]c(=O)c2n1)-c1ccc(CN(C)C=O)cc1C3 |
| InChI | InChI=1S/C19H18N4O4/c1-3-27-19(26)14-9-23-15-7-12-6-11(8-22(2)10-24)4-5-13(12)16(15)21-18(25)17(23)20-14/h4-6,9-10H,3,7-8H2,1-2H3,(H,21,25) |
| InChIKey | VWYBGIFJIGRVLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|