C21H18ClN5O4S — CID 54415250
[4-[2-chloro-4-(1,2,4-triazol-1-yl)benzoyl]-1,3-dimethylpyrazol-5-yl] 4-methylbenzenesulfonate (PubChem CID 54415250) has the molecular formula C21H18ClN5O4S and a molecular weight of 471.93 g/mol. Its IUPAC name is [4-[2-chloro-4-(1,2,4-triazol-1-yl)benzoyl]-1,3-dimethylpyrazol-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-[2-chloro-4-(1,2,4-triazol-1-yl)benzoyl]-1,3-dimethylpyrazol-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54415250 |
| Molecular Formula | C21H18ClN5O4S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | [4-[2-chloro-4-(1,2,4-triazol-1-yl)benzoyl]-1,3-dimethylpyrazol-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(=O)c3ccc(-n4cncn4)cc3Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C21H18ClN5O4S/c1-13-4-7-16(8-5-13)32(29,30)31-21-19(14(2)25-26(21)3)20(28)17-9-6-15(10-18(17)22)27-12-23-11-24-27/h4-12H,1-3H3 |
| InChIKey | VWYFXYJLEMTYMW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|