About propyl 3-iminopropanoate
propyl 3-iminopropanoate (PubChem CID 54416384) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is propyl 3-iminopropanoate.
Molecular Properties
| Compound Name | propyl 3-iminopropanoate |
| PubChem CID | 54416384 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | propyl 3-iminopropanoate |
| SMILES | [H]/N=C/CC(=O)OCCC |
| InChI | InChI=1S/C6H11NO2/c1-2-5-9-6(8)3-4-7/h4,7H,2-3,5H2,1H3/b7-4+ |
| InChIKey | VXSSNVJBDSAXRS-QPJJXVBHSA-N |
| XLogP | 0.98 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-iminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-iminopropanoate?
The IUPAC name of propyl 3-iminopropanoate (CID 54416384) is propyl 3-iminopropanoate.
What is the SMILES notation for propyl 3-iminopropanoate?
The canonical SMILES for propyl 3-iminopropanoate is [H]/N=C/CC(=O)OCCC.
What is the InChIKey of propyl 3-iminopropanoate?
The InChIKey is VXSSNVJBDSAXRS-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-5-9-6(8)3-4-7/h4,7H,2-3,5H2,1H3/b7-4+.
What are the key properties of propyl 3-iminopropanoate?
propyl 3-iminopropanoate has a molecular weight of 129.16 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-iminopropanoate is sourced from PubChem (CID 54416384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).