About 6-bromo-3-methylhexa-3,5-dienal
6-bromo-3-methylhexa-3,5-dienal (PubChem CID 54416500) has the molecular formula C7H9BrO
and a molecular weight of 189.05 g/mol. Its IUPAC name is 6-bromo-3-methylhexa-3,5-dienal.
Molecular Properties
| Compound Name | 6-bromo-3-methylhexa-3,5-dienal |
| PubChem CID | 54416500 |
| Molecular Formula | C7H9BrO |
| Molecular Weight | 189.05 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 6-bromo-3-methylhexa-3,5-dienal |
| SMILES | CC(=CC=CBr)CC=O |
| InChI | InChI=1S/C7H9BrO/c1-7(4-6-9)3-2-5-8/h2-3,5-6H,4H2,1H3 |
| InChIKey | VXUYJCMQZUURHA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.05 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-methylhexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-methylhexa-3,5-dienal?
The IUPAC name of 6-bromo-3-methylhexa-3,5-dienal (CID 54416500) is 6-bromo-3-methylhexa-3,5-dienal.
What is the SMILES notation for 6-bromo-3-methylhexa-3,5-dienal?
The canonical SMILES for 6-bromo-3-methylhexa-3,5-dienal is CC(=CC=CBr)CC=O.
What is the InChIKey of 6-bromo-3-methylhexa-3,5-dienal?
The InChIKey is VXUYJCMQZUURHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrO/c1-7(4-6-9)3-2-5-8/h2-3,5-6H,4H2,1H3.
What are the key properties of 6-bromo-3-methylhexa-3,5-dienal?
6-bromo-3-methylhexa-3,5-dienal has a molecular weight of 189.05 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-methylhexa-3,5-dienal is sourced from PubChem (CID 54416500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).