C19H17F15O4S — CID 54416840
1-[6,6-difluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexyl]sulfonyl-4-methylbenzene (PubChem CID 54416840) has the molecular formula C19H17F15O4S and a molecular weight of 626.38 g/mol. Its IUPAC name is 1-[6,6-difluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[6,6-difluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 54416840 |
| Molecular Formula | C19H17F15O4S |
| Molecular Weight | 626.38 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | 1-[6,6-difluoro-6-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]hexyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F15O4S/c1-11-5-7-12(8-6-11)39(35,36)10-4-2-3-9-13(20,21)37-18(31,32)19(33,34)38-17(29,30)15(24,25)14(22,23)16(26,27)28/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | VYBBSXLSISWUKP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.38 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|