C16H19F3N4O2 — CID 54416850
prop-2-enyl 4-amino-6-methyl-1-(5,5,5-trifluoropentyl)pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 54416850) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is prop-2-enyl 4-amino-6-methyl-1-(5,5,5-trifluoropentyl)pyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | prop-2-enyl 4-amino-6-methyl-1-(5,5,5-trifluoropentyl)pyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 54416850 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | prop-2-enyl 4-amino-6-methyl-1-(5,5,5-trifluoropentyl)pyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)nc2c(cnn2CCCCC(F)(F)F)c1N |
| InChI | InChI=1S/C16H19F3N4O2/c1-3-8-25-15(24)12-10(2)22-14-11(13(12)20)9-21-23(14)7-5-4-6-16(17,18)19/h3,9H,1,4-8H2,2H3,(H2,20,22) |
| InChIKey | VYBGCYFLYIWKMO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|