About ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate
ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate (PubChem CID 54417411) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate |
| PubChem CID | 54417411 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate |
| SMILES | CCOC(=O)c1c(=O)[nH]n2c(C)csc12 |
| InChI | InChI=1S/C9H10N2O3S/c1-3-14-9(13)6-7(12)10-11-5(2)4-15-8(6)11/h4H,3H2,1-2H3,(H,10,12) |
| InChIKey | VYKNXMKOTNSWHJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate?
The IUPAC name of ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate (CID 54417411) is ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate.
What is the SMILES notation for ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate?
The canonical SMILES for ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate is CCOC(=O)c1c(=O)[nH]n2c(C)csc12.
What is the InChIKey of ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate?
The InChIKey is VYKNXMKOTNSWHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3S/c1-3-14-9(13)6-7(12)10-11-5(2)4-15-8(6)11/h4H,3H2,1-2H3,(H,10,12).
What are the key properties of ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate?
ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate has a molecular weight of 226.26 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-6-oxo-5H-pyrazolo[5,1-b][1,3]thiazole-7-carboxylate is sourced from PubChem (CID 54417411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).