About 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal
3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal (PubChem CID 54417966) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal.
Molecular Properties
| Compound Name | 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal |
| PubChem CID | 54417966 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal |
| SMILES | CC(C=CCC1(C)OCCO1)=CC=O |
| InChI | InChI=1S/C11H16O3/c1-10(5-7-12)4-3-6-11(2)13-8-9-14-11/h3-5,7H,6,8-9H2,1-2H3 |
| InChIKey | VYTXUSFKFHUZIA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal?
The IUPAC name of 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal (CID 54417966) is 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal.
What is the SMILES notation for 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal?
The canonical SMILES for 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal is CC(C=CCC1(C)OCCO1)=CC=O.
What is the InChIKey of 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal?
The InChIKey is VYTXUSFKFHUZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-10(5-7-12)4-3-6-11(2)13-8-9-14-11/h3-5,7H,6,8-9H2,1-2H3.
What are the key properties of 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal?
3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal has a molecular weight of 196.25 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)hexa-2,4-dienal is sourced from PubChem (CID 54417966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).