About N,N-bis(hydroxymethyl)octadeca-9,12-dienamide
N,N-bis(hydroxymethyl)octadeca-9,12-dienamide (PubChem CID 54417976) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is N,N-bis(hydroxymethyl)octadeca-9,12-dienamide.
Molecular Properties
| Compound Name | N,N-bis(hydroxymethyl)octadeca-9,12-dienamide |
| PubChem CID | 54417976 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | N,N-bis(hydroxymethyl)octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)N(CO)CO |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)21(18-22)19-23/h6-7,9-10,22-23H,2-5,8,11-19H2,1H3 |
| InChIKey | VYUBIRDROORXJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(hydroxymethyl)octadeca-9,12-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(hydroxymethyl)octadeca-9,12-dienamide?
The IUPAC name of N,N-bis(hydroxymethyl)octadeca-9,12-dienamide (CID 54417976) is N,N-bis(hydroxymethyl)octadeca-9,12-dienamide.
What is the SMILES notation for N,N-bis(hydroxymethyl)octadeca-9,12-dienamide?
The canonical SMILES for N,N-bis(hydroxymethyl)octadeca-9,12-dienamide is CCCCCC=CCC=CCCCCCCCC(=O)N(CO)CO.
What is the InChIKey of N,N-bis(hydroxymethyl)octadeca-9,12-dienamide?
The InChIKey is VYUBIRDROORXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)21(18-22)19-23/h6-7,9-10,22-23H,2-5,8,11-19H2,1H3.
What are the key properties of N,N-bis(hydroxymethyl)octadeca-9,12-dienamide?
N,N-bis(hydroxymethyl)octadeca-9,12-dienamide has a molecular weight of 339.52 g/mol, XLogP of 4.53, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(hydroxymethyl)octadeca-9,12-dienamide is sourced from PubChem (CID 54417976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).