About [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite
[[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite (PubChem CID 54418588) has the molecular formula C11H16BrClNOPS2
and a molecular weight of 388.72 g/mol. Its IUPAC name is [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite.
Molecular Properties
| Compound Name | [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite |
| PubChem CID | 54418588 |
| Molecular Formula | C11H16BrClNOPS2 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite |
| SMILES | CCP(=S)(Oc1ccc(Cl)cc1)N(SBr)C(C)C |
| InChI | InChI=1S/C11H16BrClNOPS2/c1-4-16(17,14(18-12)9(2)3)15-11-7-5-10(13)6-8-11/h5-9H,4H2,1-3H3 |
| InChIKey | VZEKSDOGRBVUNP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite?
The IUPAC name of [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite (CID 54418588) is [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite.
What is the SMILES notation for [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite?
The canonical SMILES for [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite is CCP(=S)(Oc1ccc(Cl)cc1)N(SBr)C(C)C.
What is the InChIKey of [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite?
The InChIKey is VZEKSDOGRBVUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrClNOPS2/c1-4-16(17,14(18-12)9(2)3)15-11-7-5-10(13)6-8-11/h5-9H,4H2,1-3H3.
What are the key properties of [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite?
[[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite has a molecular weight of 388.72 g/mol, XLogP of 5.72, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(4-chlorophenoxy)-ethylphosphinothioyl]-propan-2-ylamino] thiohypobromite is sourced from PubChem (CID 54418588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).