C17H23N3 — CID 54418825
(6aR,9S)-4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-amine (PubChem CID 54418825) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is (6aR,9S)-4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-amine.
| Compound Name | (6aR,9S)-4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-amine |
|---|---|
| PubChem CID | 54418825 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (6aR,9S)-4-ethyl-7-methyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-amine |
| SMILES | CCn1cc2c3c(cccc31)C1C[C@H](N)CN(C)[C@@H]1C2 |
| InChI | InChI=1S/C17H23N3/c1-3-20-9-11-7-16-14(8-12(18)10-19(16)2)13-5-4-6-15(20)17(11)13/h4-6,9,12,14,16H,3,7-8,10,18H2,1-2H3/t12-,14?,16+/m0/s1 |
| InChIKey | VZIZRSMGQFGWBR-RAAOQPIXSA-N |
| XLogP | 2.33 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|