C14H12F3N5 — CID 54419205
N,N,5-trimethyl-6-(2,3,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 54419205) has the molecular formula C14H12F3N5 and a molecular weight of 307.28 g/mol. Its IUPAC name is N,N,5-trimethyl-6-(2,3,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N,N,5-trimethyl-6-(2,3,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 54419205 |
| Molecular Formula | C14H12F3N5 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N,N,5-trimethyl-6-(2,3,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(N(C)C)c1-c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C14H12F3N5/c1-7-10(11-8(15)4-5-9(16)12(11)17)13(21(2)3)22-14(20-7)18-6-19-22/h4-6H,1-3H3 |
| InChIKey | VZPLNAZAAOEHGH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|