C20H24N2O4 — CID 54419404
(2R,3R)-2,3-dihydroxy-N,N'-bis(1-phenylethyl)butanediamide (PubChem CID 54419404) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N,N'-bis(1-phenylethyl)butanediamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N,N'-bis(1-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 54419404 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N,N'-bis(1-phenylethyl)butanediamide |
| SMILES | CC(NC(=O)[C@H](O)[C@@H](O)C(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-13(15-9-5-3-6-10-15)21-19(25)17(23)18(24)20(26)22-14(2)16-11-7-4-8-12-16/h3-14,17-18,23-24H,1-2H3,(H,21,25)(H,22,26)/t13?,14?,17-,18-/m1/s1 |
| InChIKey | VZSJUBSKKNIJEU-VKYMVXLJSA-N |
| XLogP | 1.46 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |