C16H18ClN3O3 — CID 54419594
propan-2-yl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate (PubChem CID 54419594) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is propan-2-yl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate.
| Compound Name | propan-2-yl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate |
|---|---|
| PubChem CID | 54419594 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | propan-2-yl 3-[2-chloro-3-(ethylcarbamoyl)phenyl]imino-2-cyanopropanoate |
| SMILES | CCNC(=O)c1cccc(/N=C/C(C#N)C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-4-19-15(21)12-6-5-7-13(14(12)17)20-9-11(8-18)16(22)23-10(2)3/h5-7,9-11H,4H2,1-3H3,(H,19,21)/b20-9+ |
| InChIKey | VZVUKWXRKZHTIQ-AWQFTUOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|