About 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid
5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid (PubChem CID 54419962) has the molecular formula C16H15Cl2NO4
and a molecular weight of 356.21 g/mol. Its IUPAC name is 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid |
| PubChem CID | 54419962 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid |
| SMILES | COCCOC(=CC=Cc1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)O |
| InChI | InChI=1S/C16H15Cl2NO4/c1-22-5-6-23-15(16(20)21)4-2-3-11-7-10-8-12(17)13(18)9-14(10)19-11/h2-4,7-9,19H,5-6H2,1H3,(H,20,21) |
| InChIKey | WACJCVXENYLQJF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid?
The IUPAC name of 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid (CID 54419962) is 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid.
What is the SMILES notation for 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid?
The canonical SMILES for 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid is COCCOC(=CC=Cc1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)O.
What is the InChIKey of 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid?
The InChIKey is WACJCVXENYLQJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO4/c1-22-5-6-23-15(16(20)21)4-2-3-11-7-10-8-12(17)13(18)9-14(10)19-11/h2-4,7-9,19H,5-6H2,1H3,(H,20,21).
What are the key properties of 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid?
5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid has a molecular weight of 356.21 g/mol, XLogP of 4.12, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoic acid is sourced from PubChem (CID 54419962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).