About [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane
[(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane (PubChem CID 54420095) has the molecular formula C14H27IOSi
and a molecular weight of 366.36 g/mol. Its IUPAC name is [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane |
| PubChem CID | 54420095 |
| Molecular Formula | C14H27IOSi |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane |
| SMILES | CCCC[C@@H]1CCC[C@@]1(C=CI)O[Si](C)(C)C |
| InChI | InChI=1S/C14H27IOSi/c1-5-6-8-13-9-7-10-14(13,11-12-15)16-17(2,3)4/h11-13H,5-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | WAEMCVHGOAFHIO-KGLIPLIRSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane?
The IUPAC name of [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane (CID 54420095) is [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane.
What is the SMILES notation for [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane?
The canonical SMILES for [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane is CCCC[C@@H]1CCC[C@@]1(C=CI)O[Si](C)(C)C.
What is the InChIKey of [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane?
The InChIKey is WAEMCVHGOAFHIO-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H27IOSi/c1-5-6-8-13-9-7-10-14(13,11-12-15)16-17(2,3)4/h11-13H,5-10H2,1-4H3/t13-,14+/m1/s1.
What are the key properties of [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane?
[(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane has a molecular weight of 366.36 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-butyl-1-(2-iodoethenyl)cyclopentyl]oxy-trimethylsilane is sourced from PubChem (CID 54420095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).