C21H30I3N3O7 — CID 54420398
3,5-bis[acetyl(3,4-dihydroxybutyl)amino]-N-ethyl-2,4,6-triiodobenzamide (PubChem CID 54420398) has the molecular formula C21H30I3N3O7 and a molecular weight of 817.20 g/mol. Its IUPAC name is 3,5-bis[acetyl(3,4-dihydroxybutyl)amino]-N-ethyl-2,4,6-triiodobenzamide.
| Compound Name | 3,5-bis[acetyl(3,4-dihydroxybutyl)amino]-N-ethyl-2,4,6-triiodobenzamide |
|---|---|
| PubChem CID | 54420398 |
| Molecular Formula | C21H30I3N3O7 |
| Molecular Weight | 817.20 g/mol |
| Exact Mass | 816.92 |
| IUPAC Name | 3,5-bis[acetyl(3,4-dihydroxybutyl)amino]-N-ethyl-2,4,6-triiodobenzamide |
| SMILES | CCNC(=O)c1c(I)c(N(CCC(O)CO)C(C)=O)c(I)c(N(CCC(O)CO)C(C)=O)c1I |
| InChI | InChI=1S/C21H30I3N3O7/c1-4-25-21(34)15-16(22)19(26(11(2)30)7-5-13(32)9-28)18(24)20(17(15)23)27(12(3)31)8-6-14(33)10-29/h13-14,28-29,32-33H,4-10H2,1-3H3,(H,25,34) |
| InChIKey | WAKCWROVFQXNCM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|