C20H20F3N3O5 — CID 54420733
[1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]pyrazol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 54420733) has the molecular formula C20H20F3N3O5 and a molecular weight of 439.39 g/mol. Its IUPAC name is [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]pyrazol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]pyrazol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54420733 |
| Molecular Formula | C20H20F3N3O5 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]pyrazol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)=C(C)c1c([N+](=O)[O-])ccc(C(=O)c2c(C)nn(C)c2OC(=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C20H20F3N3O5/c1-9(2)10(3)15-11(4)13(7-8-14(15)26(29)30)17(27)16-12(5)24-25(6)18(16)31-19(28)20(21,22)23/h7-8H,1-6H3 |
| InChIKey | WAPSYVDPEJLXLK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|