C20H21ClN6O2 — CID 54421199
10-(2-chloro-6-methylphenyl)-12-N-(2,2-dimethoxyethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine (PubChem CID 54421199) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 10-(2-chloro-6-methylphenyl)-12-N-(2,2-dimethoxyethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine.
| Compound Name | 10-(2-chloro-6-methylphenyl)-12-N-(2,2-dimethoxyethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
|---|---|
| PubChem CID | 54421199 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 10-(2-chloro-6-methylphenyl)-12-N-(2,2-dimethoxyethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
| SMILES | COC(CNc1cc(-c2c(C)cccc2Cl)c2nc(N)c3cncn3c2n1)OC |
| InChI | InChI=1S/C20H21ClN6O2/c1-11-5-4-6-13(21)17(11)12-7-15(24-9-16(28-2)29-3)25-20-18(12)26-19(22)14-8-23-10-27(14)20/h4-8,10,16H,9H2,1-3H3,(H2,22,26)(H,24,25) |
| InChIKey | WAXNFVJHGNLFJV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|